4-Hydroxy-6-nitro-2-naphthoic acid structure
|
Common Name | 4-Hydroxy-6-nitro-2-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 64955-19-7 | Molecular Weight | 233.17700 | |
| Density | 1.593g/cm3 | Boiling Point | 504.2ºC at 760 mmHg | |
| Molecular Formula | C11H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.2ºC | |
| Name | 4-Hydroxy-6-nitro-2-naphthoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593g/cm3 |
|---|---|
| Boiling Point | 504.2ºC at 760 mmHg |
| Molecular Formula | C11H7NO5 |
| Molecular Weight | 233.17700 |
| Flash Point | 222.2ºC |
| Exact Mass | 233.03200 |
| PSA | 103.35000 |
| LogP | 2.67500 |
| Index of Refraction | 1.747 |
| InChIKey | DMHYMOJTAGLZHZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)c2cc([N+](=O)[O-])ccc2c1 |
|
~%
4-Hydroxy-6-nit... CAS#:64955-19-7 |
| Literature: Beech; Legg Journal of the Chemical Society, 1949 , p. 1887 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-hydroxy-6-methyltetrahydro-2-pyrone |
| 4-Hydroxy-6-methyl-tetrahydro-pyran-2-on |
| 4-hydroxy-6-methyl-tetrahydro-2H-pyran-2-one |
| 4-hydroxy-6-methyl-tetrahydro-pyran-2-one |
| 3-Hydroxy-5-hexanolid |