methyl 5-(4-chlorophenyl)thiophene-2-carboxylate structure
|
Common Name | methyl 5-(4-chlorophenyl)thiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 649569-56-2 | Molecular Weight | 252.71700 | |
| Density | 1.302g/cm3 | Boiling Point | 378.6ºC at 760 mmHg | |
| Molecular Formula | C12H9ClO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | methyl 5-(4-chlorophenyl)thiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 378.6ºC at 760 mmHg |
| Molecular Formula | C12H9ClO2S |
| Molecular Weight | 252.71700 |
| Flash Point | 182.8ºC |
| Exact Mass | 252.00100 |
| PSA | 54.54000 |
| LogP | 3.85510 |
| Index of Refraction | 1.594 |
| InChIKey | JZCUTYCKIFLPKV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(-c2ccc(Cl)cc2)s1 |
|
Name: The chemical genetic matrix (CGM) dataset as reported in Wildenhain et al. (2015) Pre...
Source: 11924
Target: N/A
External Id: CGM data for Cell Systems paper Dec 2015
|
| hms556h05 |