fasciculol B
Modify Date: 2026-01-25 00:11:42
fasciculol B structure
|
Common Name | fasciculol B | ||
|---|---|---|---|---|
| CAS Number | 64971-22-8 | Molecular Weight | 492.73100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H52O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | fasciculol B |
|---|
| Molecular Formula | C30H52O5 |
|---|---|
| Molecular Weight | 492.73100 |
| Exact Mass | 492.38100 |
| PSA | 101.15000 |
| LogP | 4.58630 |
| InChIKey | OEIWNDFVSHLYGG-LKRQAXFGSA-N |
| SMILES | CC(CCC(O)C(C)(C)O)C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(O)C(O)C(C)(C)C1CC3 |
|
Name: Cytotoxicity against human SKOV3 cells assessed as growth inhibition by SRB assay
Source: ChEMBL
Target: SK-OV-3
External Id: CHEMBL2377964
|
|
Name: Cytotoxicity against human A549 cells assessed as growth inhibition by SRB assay
Source: ChEMBL
Target: A549
External Id: CHEMBL2377963
|
|
Name: Cytotoxicity against human HCT15 cells assessed as growth inhibition by SRB assay
Source: ChEMBL
Target: HCT-15
External Id: CHEMBL2377962
|
|
Name: Cytotoxicity against human SK-MEL-2 cells assessed as growth inhibition by SRB assay
Source: ChEMBL
Target: SK-MEL-2
External Id: CHEMBL2377961
|
|
Name: Antiinflammatory activity in mouse BV2 cells assessed as inhibition of LPS-induced ni...
Source: ChEMBL
Target: BV-2
External Id: CHEMBL2377960
|
|
Name: Cytotoxicity against mouse BV2 cells assessed as cell viability by MTT assay
Source: ChEMBL
Target: BV-2
External Id: CHEMBL2377959
|
Total 6, Current Page 1 of 1
1