(4-ethenyl-3-formylphenyl) N,N-dimethylcarbamate structure
|
Common Name | (4-ethenyl-3-formylphenyl) N,N-dimethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 649722-44-1 | Molecular Weight | 219.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-ethenyl-3-formylphenyl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO3 |
|---|---|
| Molecular Weight | 219.23700 |
| Exact Mass | 219.09000 |
| PSA | 46.61000 |
| LogP | 2.20250 |
| InChIKey | CWAUEKIKVWCIEG-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(OC(=O)N(C)C)cc1C=O |
|
~%
(4-ethenyl-3-fo... CAS#:649722-44-1 |
| Literature: Toda, Narihiro; Tago, Keiko; Marumoto, Shinji; Takami, Kazuko; Ori, Mayuko; Yamada, Naho; Koyama, Kazuo; Naruto, Shunji; Abe, Kazumi; Yamazaki, Reina; Hara, Takao; Aoyagi, Atsushi; Abe, Yasuyuki; Kaneko, Tsugio; Kogen, Hiroshi Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 20 p. 4389 - 4415 |
|
~%
(4-ethenyl-3-fo... CAS#:649722-44-1 |
| Literature: Toda, Narihiro; Tago, Keiko; Marumoto, Shinji; Takami, Kazuko; Ori, Mayuko; Yamada, Naho; Koyama, Kazuo; Naruto, Shunji; Abe, Kazumi; Yamazaki, Reina; Hara, Takao; Aoyagi, Atsushi; Abe, Yasuyuki; Kaneko, Tsugio; Kogen, Hiroshi Bioorganic and Medicinal Chemistry, 2003 , vol. 11, # 20 p. 4389 - 4415 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dimethylcarbamic acid 3-formyl-4-vinylphenyl ester |
| Carbamic acid,dimethyl-,4-ethenyl-3-formylphenyl ester |