1-[2-hydroxy-5-[(2-methylanilino)methyl]phenyl]ethanone structure
|
Common Name | 1-[2-hydroxy-5-[(2-methylanilino)methyl]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 649747-85-3 | Molecular Weight | 255.31200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[2-hydroxy-5-[(2-methylanilino)methyl]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17NO2 |
|---|---|
| Molecular Weight | 255.31200 |
| Exact Mass | 255.12600 |
| PSA | 49.33000 |
| LogP | 3.58830 |
| InChIKey | JPTOBNRHUBNTJR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(CNc2ccccc2C)ccc1O |
|
~72%
1-[2-hydroxy-5-... CAS#:649747-85-3 |
| Literature: Khan; Hasan Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 8 p. 1970 - 1974 |
|
~%
1-[2-hydroxy-5-... CAS#:649747-85-3 |
| Literature: Khan; Hasan Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 8 p. 1970 - 1974 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(3'-acetyl-4'-hydroxybenzyl)-o-toluidine |
| Ethanone,1-[2-hydroxy-5-[[(2-methylphenyl)amino]methyl]phenyl] |