4-(2-cyclohexylidenehydrazinyl)-8-methyl-1H-quinolin-2-one structure
|
Common Name | 4-(2-cyclohexylidenehydrazinyl)-8-methyl-1H-quinolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 649748-92-5 | Molecular Weight | 269.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-cyclohexylidenehydrazinyl)-8-methyl-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19N3O |
|---|---|
| Molecular Weight | 269.34200 |
| Exact Mass | 269.15300 |
| PSA | 57.51000 |
| LogP | 4.05380 |
| InChIKey | GGSLXXFLYRQXGG-UHFFFAOYSA-N |
| SMILES | Cc1cccc2c(NN=C3CCCCC3)cc(=O)[nH]c12 |
|
~60%
4-(2-cyclohexyl... CAS#:649748-92-5 |
| Literature: Mulwad; Lohar Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 8 p. 1937 - 1942 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2(1H)-Quinolinone,4-(cyclohexylidenehydrazino)-8-methyl |