2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one
![2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one Structure](https://image.chemsrc.com/caspic/004/649755-64-6.png)
2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one structure
|
Common Name | 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 649755-64-6 | Molecular Weight | 261.32300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7N3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H7N3OS2 |
|---|---|
| Molecular Weight | 261.32300 |
| Exact Mass | 261.00300 |
| PSA | 125.94000 |
| LogP | 2.74760 |
| InChIKey | PMGYMNZHTMVHSQ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=S)[nH]c2nccc(-c3cccs3)c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~80%
2-sulfanylidene... CAS#:649755-64-6 |
| Literature: Hassneen, Hamdi M.; Abdallah, Tayseer A. Molecules, 2003 , vol. 8, # 3 p. 333 - 341 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pyrido[2,3-d]pyrimidin-4(1H)-one,2,3-dihydro-5-(2-thienyl)-2-thioxo |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: SMILES notation of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one is O=c1[nH]c(=S)[nH]c2nccc(-c3cccs3)c12. |
| Q: What is the English name of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: The English name of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one is 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one. |
| Q: What are the upstream materials of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: Related upstream materials(CAS) of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one: 1004-40-6;34772-98-0. |
| Q: What English synonyms does 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one have? |
| A: English synonyms of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one: Pyrido[2,3-d]pyrimidin-4(1H)-one,2,3-dihydro-5-(2-thienyl)-2-thioxo. |
| Q: What is the Chinese name of 649755-64-6? |
| A: Chinese name of 649755-64-6 is 649755-64-6. |
| Q: What is the molecular weight of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: Molecular weight of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one is 261.32300. |
| Q: What is the InChIKey of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: InChIKey of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one is PMGYMNZHTMVHSQ-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: LogP of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one is 2.74760. |
| Q: What is the polar surface area (PSA) of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: Polar surface area (PSA) of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one is 125.94000. |
| Q: What is the molecular formula of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one? |
| A: Molecular formula of 2-sulfanylidene-5-thiophen-2-yl-1H-pyrido[2,3-d]pyrimidin-4-one is C11H7N3OS2. |