Quinoline,8-methyl-5-nitro- structure
|
Common Name | Quinoline,8-methyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 64976-62-1 | Molecular Weight | 188.18300 | |
| Density | 1.298g/cm3 | Boiling Point | 351.7ºC at 760 mmHg | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5ºC | |
| Name | 8-methyl-5-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 351.7ºC at 760 mmHg |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.18300 |
| Flash Point | 166.5ºC |
| Exact Mass | 188.05900 |
| PSA | 58.71000 |
| LogP | 2.97460 |
| Index of Refraction | 1.661 |
| InChIKey | JJGAHJWKYOSGEU-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c2cccnc12 |
| Storage condition | 2-8°C |
| HS Code | 2933499090 |
|---|
|
~96%
Quinoline,8-met... CAS#:64976-62-1 |
| Literature: Osborne, Alan G.; Hurst, Lee J. Journal of Chemical Research, Miniprint, 2000 , # 12 p. 1327 - 1366 |
|
~%
Quinoline,8-met... CAS#:64976-62-1 |
| Literature: Noelting; Trautmann Chemische Berichte, 1890 , vol. 23, p. 3655 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Methyl-5-nitro-chinolin |
| 8-methyl-5-nitro-quinoline |
| 5-nitro-8-methylquinoline |