4-(5-bromopentoxy)-6-(4-fluorophenyl)-2-methylpyrimidine structure
|
Common Name | 4-(5-bromopentoxy)-6-(4-fluorophenyl)-2-methylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 649761-34-2 | Molecular Weight | 353.22900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18BrFN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(5-bromopentoxy)-6-(4-fluorophenyl)-2-methylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18BrFN2O |
|---|---|
| Molecular Weight | 353.22900 |
| Exact Mass | 352.05900 |
| PSA | 35.01000 |
| LogP | 4.53510 |
| InChIKey | FCPSGMCIIXDXNM-UHFFFAOYSA-N |
| SMILES | Cc1nc(OCCCCCBr)cc(-c2ccc(F)cc2)n1 |
|
~%
4-(5-bromopento... CAS#:649761-34-2 |
| Literature: Council of Scientific and Industrial Research Patent: US6683073 B1, 2004 ; Location in patent: Page column 8; 11; 14 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-bromopentyl-6-(4-fluorophenyl)-2-methyl-4-pyrimidyl ether |
| Pyrimidine,4-[(5-bromopentyl)oxy]-6-(4-fluorophenyl)-2-methyl |