Propanoic acid,3-[3-[bis(2-chloroethyl)amino]phenoxy]- structure
|
Common Name | Propanoic acid,3-[3-[bis(2-chloroethyl)amino]phenoxy]- | ||
|---|---|---|---|---|
| CAS Number | 64977-02-2 | Molecular Weight | 306.18500 | |
| Density | 1.303g/cm3 | Boiling Point | 431.5ºC at 760 mmHg | |
| Molecular Formula | C13H17Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.7ºC | |
| Name | 3-[3-[bis(2-chloroethyl)amino]phenoxy]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 431.5ºC at 760 mmHg |
| Molecular Formula | C13H17Cl2NO3 |
| Molecular Weight | 306.18500 |
| Flash Point | 214.7ºC |
| Exact Mass | 305.05900 |
| PSA | 49.77000 |
| LogP | 2.82410 |
| Index of Refraction | 1.569 |
| InChIKey | FEOMSJXNYZDINC-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOc1cccc(N(CCCl)CCCl)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MP 544 |
| 3-{3-[bis(2-chloroethyl)amino]phenoxy}propanoic acid |
| 3-{m-[Bis-(2-chlorethyl)-amino]-phenoxy}-propionsaeure |