(Z)-2-chloro-2-phenyl-ethenesulfonamide structure
|
Common Name | (Z)-2-chloro-2-phenyl-ethenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 64984-30-1 | Molecular Weight | 217.67300 | |
| Density | 1.419g/cm3 | Boiling Point | 369.1ºC at 760 mmHg | |
| Molecular Formula | C8H8ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177ºC | |
| Name | 2-chloro-2-phenylethenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.419g/cm3 |
|---|---|
| Boiling Point | 369.1ºC at 760 mmHg |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.67300 |
| Flash Point | 177ºC |
| Exact Mass | 216.99600 |
| PSA | 68.54000 |
| LogP | 3.29340 |
| Index of Refraction | 1.607 |
| InChIKey | CXUOPMDJULJFQA-VURMDHGXSA-N |
| SMILES | NS(=O)(=O)C=C(Cl)c1ccccc1 |
| HS Code | 2935009090 |
|---|
|
~%
(Z)-2-chloro-2-... CAS#:64984-30-1 |
| Literature: Hasegawa,K. et al. Bulletin of the Chemical Society of Japan, 1977 , vol. 50, p. 2346 - 2350 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Ethenesulfonamide,2-chloro-2-phenyl-,(Z)-(9CI) |
| (Z)-2-chloro-2-phenyl-ethenesulfonic acid amide |
| (Z)-2-CHLORO-2-PHENYL-ETHENESULFONAMIDE |