Isophthaloyl dicyanide
Modify Date: 2026-08-21 06:55:28
Isophthaloyl dicyanide structure
|
Common Name | Isophthaloyl dicyanide | ||
|---|---|---|---|---|
| CAS Number | 64985-88-2 | Molecular Weight | 184.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isophthaloyl dicyanide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H4N2O2 |
|---|---|
| Molecular Weight | 184.15 |
| InChIKey | NMFMOYLXOPIJHU-UHFFFAOYSA-N |
| SMILES | N#CC(=O)c1cccc(C(=O)C#N)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Isophthaloyl dicyanide? |
| A: SMILES notation of Isophthaloyl dicyanide is N#CC(=O)c1cccc(C(=O)C#N)c1. |
| Q: What is the CAS number of Isophthaloyl dicyanide? |
| A: CAS number of Isophthaloyl dicyanide is 64985-88-2. |
| Q: What is the Chinese name of 64985-88-2? |
| A: Chinese name of 64985-88-2 is 64985-88-2. |
| Q: What is the English name of Isophthaloyl dicyanide? |
| A: The English name of Isophthaloyl dicyanide is Isophthaloyl dicyanide. |
| Q: What is the molecular weight of Isophthaloyl dicyanide? |
| A: Molecular weight of Isophthaloyl dicyanide is 184.15. |
| Q: What is the molecular formula of Isophthaloyl dicyanide? |
| A: Molecular formula of Isophthaloyl dicyanide is C10H4N2O2. |
| Q: What is the InChIKey of Isophthaloyl dicyanide? |
| A: InChIKey of Isophthaloyl dicyanide is NMFMOYLXOPIJHU-UHFFFAOYSA-N. |