Urea,N,N'-bis[1-(acetyloxy)-2,2,2-trichloroethyl]- structure
|
Common Name | Urea,N,N'-bis[1-(acetyloxy)-2,2,2-trichloroethyl]- | ||
|---|---|---|---|---|
| CAS Number | 64989-02-2 | Molecular Weight | 438.90400 | |
| Density | 1.637g/cm3 | Boiling Point | 585.9ºC at 760 mmHg | |
| Molecular Formula | C9H10Cl6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 308.1ºC | |
| Name | [1-[(1-acetyloxy-2,2,2-trichloroethyl)carbamoylamino]-2,2, 2-trichloroethyl] acetate |
|---|
| Density | 1.637g/cm3 |
|---|---|
| Boiling Point | 585.9ºC at 760 mmHg |
| Molecular Formula | C9H10Cl6N2O5 |
| Molecular Weight | 438.90400 |
| Flash Point | 308.1ºC |
| Exact Mass | 435.87200 |
| PSA | 93.73000 |
| LogP | 3.58620 |
| Index of Refraction | 1.535 |
| InChIKey | QNIZOVDYAFMFEF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(NC(=O)NC(OC(C)=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
|
~%
Urea,N,N'-bis[1... CAS#:64989-02-2 |
| Literature: Chattaway; James Proceedings of the Royal Society of London, Series A: Mathematical, Physical and Engineering Sciences, 1931 , vol. 134, p. 372,383 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |