9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine
Modify Date: 2025-08-27 16:30:53
![9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine Structure](https://www.chemsrc.com/extcaspic/263/64993-06-2.png)
9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine structure
|
Common Name | 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine | ||
|---|---|---|---|---|
| CAS Number | 64993-06-2 | Molecular Weight | 202.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10N2O2 |
|---|---|
| Molecular Weight | 202.21 |
| InChIKey | DYMRREZETGXUKO-UHFFFAOYSA-N |
| SMILES | Cc1ccnc2c(N)cc3c(c12)OCO3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine? |
| A: Molecular weight of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine is 202.21. |
| Q: What is the Chinese name of 64993-06-2? |
| A: Chinese name of 64993-06-2 is 64993-06-2. |
| Q: What is the molecular formula of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine? |
| A: Molecular formula of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine is C11H10N2O2. |
| Q: What is the InChIKey of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine? |
| A: InChIKey of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine is DYMRREZETGXUKO-UHFFFAOYSA-N. |
| Q: What is the English name of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine? |
| A: The English name of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine is 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine. |
| Q: What is the CAS number of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine? |
| A: CAS number of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine is 64993-06-2. |
| Q: What is the SMILES notation of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine? |
| A: SMILES notation of 9-methyl-2H-[1,3]dioxolo[4,5-f]quinolin-5-amine is Cc1ccnc2c(N)cc3c(c12)OCO3. |