1,5-Diphenyl-pent-1,4-dien-3-one oxime
Modify Date: 2025-08-26 00:09:35
1,5-Diphenyl-pent-1,4-dien-3-one oxime structure
|
Common Name | 1,5-Diphenyl-pent-1,4-dien-3-one oxime | ||
|---|---|---|---|---|
| CAS Number | 6502-37-0 | Molecular Weight | 249.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(1,5-diphenylpenta-1,4-dien-3-ylidene)hydroxylamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H15NO |
|---|---|
| Molecular Weight | 249.30700 |
| Exact Mass | 249.11500 |
| PSA | 32.59000 |
| LogP | 4.24340 |
| InChIKey | QLGJJJOJYFTJJH-UHFFFAOYSA-N |
| SMILES | ON=C(C=Cc1ccccc1)C=Cc1ccccc1 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:538-58-9
CAS#:35225-79-7
CAS#:5396-91-8| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 1,5-Diphenyl-pent-1,4-dien-3-one oxime |
| 1,5-diphenyl-penta-1,4-dien-3-one oxime |
| Dibenzalacetonoxim |
| 1,5-diphenyl-1,4-pentadien-3-one oxime |
| 1,5-Diphenyl-penta-1,4-dien-3-on-oxim |