1,3,5-tris(ethenyl)-1,3,5-triazinane-2,4,6-trione structure
|
Common Name | 1,3,5-tris(ethenyl)-1,3,5-triazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 6504-96-7 | Molecular Weight | 207.18600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3,5-tris(ethenyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9N3O3 |
|---|---|
| Molecular Weight | 207.18600 |
| Exact Mass | 207.06400 |
| PSA | 66.00000 |
| InChIKey | WQDQPWGZOLWVLM-UHFFFAOYSA-N |
| SMILES | C=Cn1c(=O)n(C=C)c(=O)n(C=C)c1=O |
|
~1%
1,3,5-tris(ethe... CAS#:6504-96-7 |
| Literature: Prager, Rolf H.; Were, Stephen T. Australian Journal of Chemistry, 1991 , vol. 44, # 11 p. 1635 - 1641 |
|
~%
1,3,5-tris(ethe... CAS#:6504-96-7 |
| Literature: Prager, Rolf H.; Were, Stephen T. Australian Journal of Chemistry, 1991 , vol. 44, # 11 p. 1635 - 1641 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Trivinyl-isocyanursaeure |
| 1,3,5-triethenyl-1,3,5-triazine-2,4,6(1H,3H,5H)-trione |
| Trivinyl-isocyanurat |
| 1,3,5-trivinyl-[1,3,5]triazinane-2,4,6-trione |
| 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-triethenyl |