1H-Indole-3-carboxylic acid, 2-aminomethyl-1-ethyl-4,5,6,7-tetrachloro-, ethyl ester structure
|
Common Name | 1H-Indole-3-carboxylic acid, 2-aminomethyl-1-ethyl-4,5,6,7-tetrachloro-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 65048-02-4 | Molecular Weight | 384.08500 | |
| Density | 1.54g/cm3 | Boiling Point | 531.1ºC at 760 mmHg | |
| Molecular Formula | C14H14Cl4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275ºC | |
| Name | ethyl 2-(aminomethyl)-4,5,6,7-tetrachloro-1-ethylindole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 531.1ºC at 760 mmHg |
| Molecular Formula | C14H14Cl4N2O2 |
| Molecular Weight | 384.08500 |
| Flash Point | 275ºC |
| Exact Mass | 381.98100 |
| PSA | 57.25000 |
| LogP | 5.61050 |
| Index of Refraction | 1.629 |
| InChIKey | UIKGCIWRNVVQNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(CN)n(CC)c2c(Cl)c(Cl)c(Cl)c(Cl)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-3-carboxylic acid,2-aminomethyl-1-ethyl-4,5,6,7-tetrachloro-,ethyl ester |
| 2-Aminomethyl-1-ethyl-4,5,6,7-tetrachloro-1H-indole-3-carboxylic acid ethyl ester |