6-[3-(trifluoromethylsulfanyl)phenyl]-1,3,5-triazine-2,4-diamine structure
|
Common Name | 6-[3-(trifluoromethylsulfanyl)phenyl]-1,3,5-triazine-2,4-diamine | ||
|---|---|---|---|---|
| CAS Number | 65052-47-3 | Molecular Weight | 287.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8F3N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[3-(trifluoromethylsulfanyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8F3N5S |
|---|---|
| Molecular Weight | 287.26400 |
| Exact Mass | 287.04500 |
| PSA | 117.47000 |
| LogP | 2.17510 |
| InChIKey | RMOAECPKQODLIO-UHFFFAOYSA-N |
| SMILES | Nc1nc(N)nc(-c2cccc(SC(F)(F)F)c2)n1 |
|
~%
6-[3-(trifluoro... CAS#:65052-47-3 |
| Literature: Nippon Shinyaku Co., Ltd. Patent: US4103009 A1, 1978 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Antiulcer activity in rat at the dose of 20 mg/kg administered intraperitoneally.
Source: ChEMBL
Target: Rattus norvegicus
External Id: CHEMBL789537
|
| 6-(3-trifluoromethylsulfanyl-phenyl)-[1,3,5]triazine-2,4-diamine |
| 1,3,5-Triazine-2,4-diamine,6-[3-[(trifluoromethyl)thio]phenyl] |
| 2,4-diamino-6-(3-trifluoromethylthiophenyl)-s-triazine |