N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide
N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide structure
|
Common Name | N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide | ||
|---|---|---|---|---|
| CAS Number | 65052-77-9 | Molecular Weight | 317.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H11N3O4S |
|---|---|
| Molecular Weight | 317.32000 |
| Exact Mass | 317.04700 |
| PSA | 126.97000 |
| LogP | 4.36130 |
| InChIKey | NYYRVZAHHAKFGA-UHFFFAOYSA-N |
| SMILES | CN(C(=S)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-methyl-4-nitr... CAS#:65052-77-9 |
| Literature: Broxton,T.J. et al. Australian Journal of Chemistry, 1978 , vol. 31, p. 1731 - 1735 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:100-15-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenecarbothioamide,N-methyl-4-nitro-N-(4-nitrophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: SMILES notation of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide is CN(C(=S)c1ccc([N+](=O)[O-])cc1)c1ccc([N+](=O)[O-])cc1. |
| Q: What English synonyms does N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide have? |
| A: English synonyms of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide: Benzenecarbothioamide,N-methyl-4-nitro-N-(4-nitrophenyl). |
| Q: What is the LogP of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: LogP of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide is 4.36130. |
| Q: What is the CAS number of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: CAS number of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide is 65052-77-9. |
| Q: What are the downstream products of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: Related downstream products(CAS) of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide: 100-15-2. |
| Q: What are the upstream materials of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: Related upstream materials(CAS) of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide: 33675-69-3. |
| Q: What is the Chinese name of 65052-77-9? |
| A: Chinese name of 65052-77-9 is 65052-77-9. |
| Q: What is the molecular formula of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: Molecular formula of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide is C14H11N3O4S. |
| Q: What is the English name of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: The English name of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide is N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide. |
| Q: What is the molecular weight of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide? |
| A: Molecular weight of N-methyl-4-nitro-N-(4-nitrophenyl)benzenecarbothioamide is 317.32000. |