(1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol
Modify Date: 2026-03-02 13:27:01
(1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol structure
|
Common Name | (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 650601-06-2 | Molecular Weight | 248.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H13ClO2 |
|---|---|
| Molecular Weight | 248.7 |
| InChIKey | JKHLGCIYBRKEGD-KBPBESRZSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=C(C=C2)Cl)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 6, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 650601-06-2? |
| A: Chinese name of 650601-06-2 is 650601-06-2. |
| Q: What is the SMILES notation of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol? |
| A: SMILES notation of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol is C1=CC=C(C=C1)[C@@H]([C@H](C2=CC=C(C=C2)Cl)O)O. |
| Q: What is the molecular weight of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol? |
| A: Molecular weight of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol is 248.7. |
| Q: What is the InChIKey of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol? |
| A: InChIKey of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol is JKHLGCIYBRKEGD-KBPBESRZSA-N. |
| Q: What is the CAS number of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol? |
| A: CAS number of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol is 650601-06-2. |
| Q: What is the English name of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol? |
| A: The English name of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol is (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol. |
| Q: What is the molecular formula of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol? |
| A: Molecular formula of (1S,2S)-1-(4-Chlorophenyl)-2-phenylethane-1,2-diol is C14H13ClO2. |