(1-aminobenzo[e][1]benzofuran-2-yl)-(4-hydroxyphenyl)methanone structure
|
Common Name | (1-aminobenzo[e][1]benzofuran-2-yl)-(4-hydroxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 650636-41-2 | Molecular Weight | 303.31100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-aminobenzo[e][1]benzofuran-2-yl)-(4-hydroxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H13NO3 |
|---|---|
| Molecular Weight | 303.31100 |
| Exact Mass | 303.09000 |
| PSA | 76.46000 |
| LogP | 4.68600 |
| InChIKey | DKGUSLUFKUFPTN-UHFFFAOYSA-N |
| SMILES | Nc1c(C(=O)c2ccc(O)cc2)oc2ccc3ccccc3c12 |
|
~86%
(1-aminobenzo[e... CAS#:650636-41-2 |
| Literature: Mahadevan; Vaidya; Vagdevi Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 8 p. 1931 - 1936 |
| Methanone,(1-aminonaphtho[2,1-b]furan-2-yl)(4-hydroxyphenyl) |
| 2-(4-hydroxybenzoyl)-1-aminonaphtho[2,1-b]furan |