gold,tricyclohexyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phosphanium structure
|
Common Name | gold,tricyclohexyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phosphanium | ||
|---|---|---|---|---|
| CAS Number | 650638-99-6 | Molecular Weight | 668.47300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H33AuF5P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | gold,tricyclohexyl-[2-(2,3,4,5,6-pentafluorophenyl)ethynyl]phosphanium |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H33AuF5P+ |
|---|---|
| Molecular Weight | 668.47300 |
| Exact Mass | 668.19100 |
| PSA | 13.59000 |
| LogP | 8.70430 |
| InChIKey | VAKDSLBSTVWHRL-UHFFFAOYSA-N |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.[Au+].[C-]#Cc1c(F)c(F)c(F)c(F)c1F |
|
~%
gold,tricyclohe... CAS#:650638-99-6 |
| Literature: Lu, Wei; Zhu, Nianyong; Che, Chi-Ming Journal of the American Chemical Society, 2003 , vol. 125, # 51 p. 16081 - 16088 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Gold,[(pentafluorophenyl)ethynyl](tricyclohexylphosphine) |
| [(Cy3P)AuC2C6F5] |