ethyl 2-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]acetate structure
|
Common Name | ethyl 2-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 6507-20-6 | Molecular Weight | 273.71900 | |
| Density | 1.328g/cm3 | Boiling Point | 443.5ºC at 760 mmHg | |
| Molecular Formula | C10H16ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222ºC | |
| Name | ethyl 2-[[4-chloro-6-(propylamino)-1,3,5-triazin-2-yl]amino]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 443.5ºC at 760 mmHg |
| Molecular Formula | C10H16ClN5O2 |
| Molecular Weight | 273.71900 |
| Flash Point | 222ºC |
| Exact Mass | 273.09900 |
| PSA | 95.49000 |
| LogP | 0.16570 |
| Index of Refraction | 1.59 |
| InChIKey | BRDYHUGRYOPAIM-UHFFFAOYSA-N |
| SMILES | CCCNc1nc(Cl)nc(NCC(=O)OCC)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| N-(4-chloro-6-propylamino-[1,3,5]triazin-2-yl)-glycine ethyl ester |
| HMS1583O03 |