1H-Imidazole,4,5-bis(trifluoromethyl) structure
|
Common Name | 1H-Imidazole,4,5-bis(trifluoromethyl) | ||
|---|---|---|---|---|
| CAS Number | 651-34-3 | Molecular Weight | 204.07300 | |
| Density | 1.594g/cm3 | Boiling Point | 216.4ºC at 760 mmHg | |
| Molecular Formula | C5H2F6N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 84.7ºC | |
| Name | 4,5-bis(trifluoromethyl)-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.594g/cm3 |
|---|---|
| Boiling Point | 216.4ºC at 760 mmHg |
| Molecular Formula | C5H2F6N2 |
| Molecular Weight | 204.07300 |
| Flash Point | 84.7ºC |
| Exact Mass | 204.01200 |
| PSA | 28.68000 |
| LogP | 2.44730 |
| Index of Refraction | 1.366 |
| InChIKey | OTWRLZYPCYXBFT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1nc[nH]c1C(F)(F)F |
| HS Code | 2933290090 |
|---|
|
~80%
1H-Imidazole,4,... CAS#:651-34-3 |
| Literature: Shustov, L. D.; Nikolenko, L. N.; Senchenkova, T. M. J. Gen. Chem. USSR (Engl. Transl.), 1983 , vol. 53, # 1 p. 103 - 105,85 - 86 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-BIS(TRIFLUOROMETHYL)IMIDAZOLE |
| 4,5-Bis-trifluormethyl-imidazol |
| 4,5-bis-trifluoromethyl-1H-imidazole |