2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-benzimidazole structure
|
Common Name | 2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 6510-99-2 | Molecular Weight | 411.52200 | |
| Density | 1.29g/cm3 | Boiling Point | 686.9ºC at 760 mmHg | |
| Molecular Formula | C24H21N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.2ºC | |
| Name | 2-[[4,5-bis(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanylmethyl]-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 686.9ºC at 760 mmHg |
| Molecular Formula | C24H21N5S |
| Molecular Weight | 411.52200 |
| Flash Point | 369.2ºC |
| Exact Mass | 411.15200 |
| PSA | 84.69000 |
| LogP | 5.71970 |
| Index of Refraction | 1.706 |
| InChIKey | AGVTZADESJEXTE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nnc(SCc3nc4ccccc4[nH]3)n2-c2ccc(C)cc2)cc1 |
|
~%
2-[[4,5-bis(4-m... CAS#:6510-99-2 |
| Literature: Hagen; Bergan; Aasen 1984 , vol. 38, # 1 B p. 5 - 14 |
|
~%
2-[[4,5-bis(4-m... CAS#:6510-99-2 |
| Literature: Hagen; Bergan; Aasen 1984 , vol. 38, # 1 B p. 5 - 14 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|
| Ser-Ala-OBzl |
| 2-({[4,5-bis(4-methylphenyl)-4H-1,2,4-triazol-3-yl]sulfanyl}methyl)-1H-benzimidazole |
| CCG-4824 |