dimethyl 5-formyl-3-methyl-1H-pyrrole-2,4-dicarboxylate structure
|
Common Name | dimethyl 5-formyl-3-methyl-1H-pyrrole-2,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 65100-86-9 | Molecular Weight | 225.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 5-formyl-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO5 |
|---|---|
| Molecular Weight | 225.19800 |
| Exact Mass | 225.06400 |
| PSA | 85.46000 |
| LogP | 0.70880 |
| InChIKey | QBIVKKLJRCHHAV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1[nH]c(C=O)c(C(=O)OC)c1C |
|
~%
dimethyl 5-form... CAS#:65100-86-9 |
| Literature: Clezy, Peter S.; Crowley, Richard J.; Hai, Ton That Australian Journal of Chemistry, 1982 , vol. 35, # 2 p. 411 - 422 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| dimethyl 5-formyl-3-methylpyrrole-2,4-dicarboxylate |
| 1H-Pyrrole-2,4-dicarboxylic acid,5-formyl-3-methyl-,dimethyl ester |