2-(4-[4-(TRIFLUOROMETHYL)PYRIMIDIN-2-YL] structure
|
Common Name | 2-(4-[4-(TRIFLUOROMETHYL)PYRIMIDIN-2-YL] | ||
|---|---|---|---|---|
| CAS Number | 651004-99-8 | Molecular Weight | 276.25800 | |
| Density | 1.329g/cm3 | Boiling Point | 402.1ºC at 760 mmHg | |
| Molecular Formula | C11H15F3N4O | Melting Point | 70ºC | |
| MSDS | N/A | Flash Point | 197ºC | |
| Name | 2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 402.1ºC at 760 mmHg |
| Melting Point | 70ºC |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.25800 |
| Flash Point | 197ºC |
| Exact Mass | 276.12000 |
| PSA | 52.49000 |
| LogP | 0.61260 |
| Index of Refraction | 1.509 |
| InChIKey | AWGYMFGFNLYHOH-UHFFFAOYSA-N |
| SMILES | OCCN1CCN(c2nccc(C(F)(F)F)n2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-{4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazino}ethan-1-ol |
| 2-(4-(4-(Trifluoromethyl)pyrimidin-2-yl)piperazin-1-yl)ethanol |
| HMS542O09 |