2-[2-[[4-[(2-bromo-4,6-dinitrophenyl)azo]-1-naphthyl]amino]ethoxy]ethanol structure
|
Common Name | 2-[2-[[4-[(2-bromo-4,6-dinitrophenyl)azo]-1-naphthyl]amino]ethoxy]ethanol | ||
|---|---|---|---|---|
| CAS Number | 65104-24-7 | Molecular Weight | 376.82500 | |
| Density | 1.62g/cm3 | Boiling Point | 729.4ºC at 760 mmHg | |
| Molecular Formula | C7H5Br3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 394.9ºC | |
| Name | 2,2,2-tribromoethyl furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 729.4ºC at 760 mmHg |
| Molecular Formula | C7H5Br3O3 |
| Molecular Weight | 376.82500 |
| Flash Point | 394.9ºC |
| Exact Mass | 373.77900 |
| PSA | 39.44000 |
| LogP | 3.27490 |
| Index of Refraction | 1.681 |
| InChIKey | UWVWXCLYUOTGDJ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c(N=Nc2ccc(NCCOCCO)c3ccccc23)c([N+](=O)[O-])c1 |
| 2-Furoic acid,ester with tribromoethanol |
| Tribromoethyl 2-furoate |
| 2,2,2-tribromoethyl 2-furoate |
| 2-Furoic acid,2,2,2-tribromoethyl ester |