N-Carbomethoxyarginine
Modify Date: 2025-09-10 12:03:50
N-Carbomethoxyarginine structure
|
Common Name | N-Carbomethoxyarginine | ||
|---|---|---|---|---|
| CAS Number | 651043-21-9 | Molecular Weight | 232.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-Carbomethoxyarginine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H16N4O4 |
|---|---|
| Molecular Weight | 232.24 |
| InChIKey | WXFJKKQCYVDUIM-YFKPBYRVSA-N |
| SMILES | COC(=O)NC(CCCN=C(N)N)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-Carbomethoxyarginine? |
| A: Molecular weight of N-Carbomethoxyarginine is 232.24. |
| Q: What is the English name of N-Carbomethoxyarginine? |
| A: The English name of N-Carbomethoxyarginine is N-Carbomethoxyarginine. |
| Q: What is the CAS number of N-Carbomethoxyarginine? |
| A: CAS number of N-Carbomethoxyarginine is 651043-21-9. |
| Q: What is the molecular formula of N-Carbomethoxyarginine? |
| A: Molecular formula of N-Carbomethoxyarginine is C8H16N4O4. |
| Q: What is the InChIKey of N-Carbomethoxyarginine? |
| A: InChIKey of N-Carbomethoxyarginine is WXFJKKQCYVDUIM-YFKPBYRVSA-N. |
| Q: What is the Chinese name of 651043-21-9? |
| A: Chinese name of 651043-21-9 is 651043-21-9. |
| Q: What is the SMILES notation of N-Carbomethoxyarginine? |
| A: SMILES notation of N-Carbomethoxyarginine is COC(=O)NC(CCCN=C(N)N)C(=O)O. |