N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide
![N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide Structure](https://image.chemsrc.com/caspic/416/65115-07-3.png)
N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide structure
|
Common Name | N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide | ||
|---|---|---|---|---|
| CAS Number | 65115-07-3 | Molecular Weight | 414.62200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H46N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide, Chinese name unavailable, CAS number 65115-07-3, molecular formula C23H46N2O4, molecular weight 414.62200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C23H46N2O4 |
|---|---|
| Molecular Weight | 414.62200 |
| Exact Mass | 414.34600 |
| PSA | 59.08000 |
| LogP | 4.26730 |
| InChIKey | VAQKCJZAOPTDST-UHFFFAOYSA-N |
| SMILES | CCCCCCCN(C)C(=O)COCCCOCC(=O)N(C)CCCCCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-heptyl-2-[3-[... CAS#:65115-07-3 |
| Literature: Kirsch; Funck,; Pretsch; Simon Helvetica chimica acta, 1977 , vol. 60, # 7 p. 2326 - 2333 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetamide,2,2'-[1,3-propanediylbis(oxy)]bis[N-heptyl-N-methyl |
| N-Heptyl-2-{3-[(heptyl-methyl-carbamoyl)-methoxy]-propoxy}-N-methyl-acetamide |
| N,N'-Diheptyl-N,N'-dimethyl-3,7-dioxa-nonandiamid |
| n-Heptyl-2-(3-(2-[heptyl(methyl)amino]-2-oxoethoxy)propoxy)-N-methylacetamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide have? |
| A: English synonyms of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide: Acetamide,2,2'-[1,3-propanediylbis(oxy)]bis[N-heptyl-N-methyl, N-Heptyl-2-{3-[(heptyl-methyl-carbamoyl)-methoxy]-propoxy}-N-methyl-acetamide, N,N'-Diheptyl-N,N'-dimethyl-3,7-dioxa-nonandiamid, n-Heptyl-2-(3-(2-[heptyl(methyl)amino]-2-oxoethoxy)propoxy)-N-methylacetamide. |
| Q: What is the InChIKey of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: InChIKey of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide is VAQKCJZAOPTDST-UHFFFAOYSA-N. |
| Q: What is the English name of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: The English name of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide is N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide. |
| Q: What are the upstream materials of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: Related upstream materials(CAS) of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide: 108444-76-4;36343-05-2. |
| Q: What is the polar surface area (PSA) of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: Polar surface area (PSA) of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide is 59.08000. |
| Q: What is the Chinese name of 65115-07-3? |
| A: Chinese name of 65115-07-3 is 65115-07-3. |
| Q: What is the CAS number of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: CAS number of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide is 65115-07-3. |
| Q: What is the molecular weight of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: Molecular weight of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide is 414.62200. |
| Q: What is the molecular formula of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: Molecular formula of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide is C23H46N2O4. |
| Q: What is the SMILES notation of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide? |
| A: SMILES notation of N-heptyl-2-[3-[2-[heptyl(methyl)amino]-2-oxoethoxy]propoxy]-N-methylacetamide is CCCCCCCN(C)C(=O)COCCCOCC(=O)N(C)CCCCCCC. |