methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate
methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate structure
|
Common Name | methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 651305-80-5 | Molecular Weight | 299.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H9NO6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate, CAS号651305-80-5, molecular formula C7H9NO6S3, molecular weight 299.34400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H9NO6S3 |
|---|---|
| Molecular Weight | 299.34400 |
| Exact Mass | 298.95900 |
| PSA | 152.47000 |
| LogP | 1.89830 |
| InChIKey | LKPPEPOQPWVGIP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(S(C)(=O)=O)nsc1S(C)(=O)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:651305-81-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,5-bis-methanesulfonylisothiazole-4-carboxylic acid methyl ester |
| 4-Isothiazolecarboxylic acid,3,5-bis(methylsulfonyl)-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: LogP of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate is 1.89830. |
| Q: What is the molecular formula of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: Molecular formula of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate is C7H9NO6S3. |
| Q: What is the English name of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: The English name of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate is methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate. |
| Q: What are the downstream products of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: Related downstream products(CAS) of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate: 651305-81-6. |
| Q: What is the InChIKey of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: InChIKey of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate is LKPPEPOQPWVGIP-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: Polar surface area (PSA) of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate is 152.47000. |
| Q: What is the molecular weight of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: Molecular weight of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate is 299.34400. |
| Q: What English synonyms does methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate have? |
| A: English synonyms of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate: 3,5-bis-methanesulfonylisothiazole-4-carboxylic acid methyl ester, 4-Isothiazolecarboxylic acid,3,5-bis(methylsulfonyl)-,methyl ester. |
| Q: What is the Chinese name of 651305-80-5? |
| A: Chinese name of 651305-80-5 is 651305-80-5. |
| Q: What is the SMILES notation of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate? |
| A: SMILES notation of methyl 3,5-bis(methylsulfonyl)-1,2-thiazole-4-carboxylate is COC(=O)c1c(S(C)(=O)=O)nsc1S(C)(=O)=O. |