1(2H)-Isoquinolinone,3,4-dihydro-6,7-dimethoxy-2-methyl- structure
|
Common Name | 1(2H)-Isoquinolinone,3,4-dihydro-6,7-dimethoxy-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 6514-05-2 | Molecular Weight | 221.25200 | |
| Density | 1.153g/cm3 | Boiling Point | 400.4ºC at 760mmHg | |
| Molecular Formula | C12H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196ºC | |
Use of 1(2H)-Isoquinolinone,3,4-dihydro-6,7-dimethoxy-2-methyl-N-Methylcorydaldine, an alkaloid, shows promising anti-secretory activity[1]. |
| Name | 6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | N-Methylcorydaldine, an alkaloid, shows promising anti-secretory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 400.4ºC at 760mmHg |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.25200 |
| Flash Point | 196ºC |
| Exact Mass | 221.10500 |
| PSA | 38.77000 |
| LogP | 1.26980 |
| Index of Refraction | 1.54 |
| InChIKey | BDIZBBGNYDRCCA-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1OC)C(=O)N(C)CC2 |
| HS Code | 2933790090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| N-Methylcorydaldine |
| 6,7-dimethoxy-2-methyl-3,4-dihydro-2H-isoquinolin-1-one |
| 6,7-Dimethoxy-2-methyl-3,4-dihydro-2H-isochinolin-1-on |
| 6,7-dimethoxy-N-methyl-2H-3,4-dihydroisoquinolin-1-one |