9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one
![9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one Structure](https://image.chemsrc.com/caspic/384/65161-79-7.png)
9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one structure
|
Common Name | 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one | ||
|---|---|---|---|---|
| CAS Number | 65161-79-7 | Molecular Weight | 242.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 9-Hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one (CAS number: 65161-79-7), molecular formula C14H10O4, molecular weight 242.22700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H10O4 |
|---|---|
| Molecular Weight | 242.22700 |
| Exact Mass | 242.05800 |
| PSA | 63.58000 |
| LogP | 2.97330 |
| InChIKey | SHPOBNSZWVVOTR-UHFFFAOYSA-N |
| SMILES | C=CCc1c2ccoc2c(O)c2oc(=O)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
9-hydroxy-4-pro... CAS#:65161-79-7 |
| Literature: Loutfy; Khatibie Pharmazie, 1983 , vol. 38, # 2 p. 137 - 138 |
|
~%
9-hydroxy-4-pro... CAS#:65161-79-7 |
| Literature: Loutfy; Khatibie Pharmazie, 1983 , vol. 38, # 2 p. 137 - 138 |
|
~%
9-hydroxy-4-pro... CAS#:65161-79-7 |
| Literature: Loutfy; Khatibie Pharmazie, 1983 , vol. 38, # 2 p. 137 - 138 |
![9-prop-2-enoxyfuro[3,2-g]chromen-7-one structure](https://image.chemsrc.com/caspic/180/62188-89-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 7H-Furo[3,2-g][1]benzopyran-7-one,9-hydroxy-4-(2-propenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: CAS number of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one is 65161-79-7. |
| Q: What is the LogP of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: LogP of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one is 2.97330. |
| Q: What is the Chinese name of 65161-79-7? |
| A: Chinese name of 65161-79-7 is 65161-79-7. |
| Q: What is the SMILES notation of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: SMILES notation of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one is C=CCc1c2ccoc2c(O)c2oc(=O)ccc12. |
| Q: What are the upstream materials of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: Related upstream materials(CAS) of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one: 2009-24-7;482-44-0;62188-89-0. |
| Q: What is the molecular formula of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: Molecular formula of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one is C14H10O4. |
| Q: What is the molecular weight of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: Molecular weight of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one is 242.22700. |
| Q: What is the polar surface area (PSA) of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: Polar surface area (PSA) of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one is 63.58000. |
| Q: What is the English name of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one? |
| A: The English name of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one is 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one. |
| Q: What English synonyms does 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one have? |
| A: English synonyms of 9-hydroxy-4-prop-2-enylfuro[3,2-g]chromen-7-one: 7H-Furo[3,2-g][1]benzopyran-7-one,9-hydroxy-4-(2-propenyl). |