bis[2-(dimethylamino)ethyl] hexanedioate structure
|
Common Name | bis[2-(dimethylamino)ethyl] hexanedioate | ||
|---|---|---|---|---|
| CAS Number | 65169-69-9 | Molecular Weight | 288.38300 | |
| Density | 1.025 g/cm3 | Boiling Point | 353.4ºC at 760 mmHg | |
| Molecular Formula | C14H28N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.5ºC | |
| Name | bis[2-(dimethylamino)ethyl] hexanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.025 g/cm3 |
|---|---|
| Boiling Point | 353.4ºC at 760 mmHg |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.38300 |
| Flash Point | 167.5ºC |
| Exact Mass | 288.20500 |
| PSA | 59.08000 |
| LogP | 0.75640 |
| Index of Refraction | 1.466 |
| InChIKey | LQIWJZRUBHDHFH-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(=O)CCCCC(=O)OCCN(C)C |
| HS Code | 2922499990 |
|---|
|
~%
bis[2-(dimethyl... CAS#:65169-69-9 |
| Literature: Phillips Journal of the American Chemical Society, 1949 , vol. 71, p. 3264 |
|
~%
bis[2-(dimethyl... CAS#:65169-69-9 |
| Literature: Fusco et al. Gazzetta Chimica Italiana, 1949 , vol. 79, p. 130 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Adipicacid,bis(2-dimethylaminoethyl) ester (6CI) |
| adipic acid bis-(2-dimethylamino-ethyl ester) |
| Hexanedioic acid,bis[2-(dimethylamino)ethyl] ester (9CI) |
| BIS[2-(DIMETHYLAMINO)ETHYL] ADIPATE |
| EINECS 265-591-1 |
| Hexanedioic acid,1,6-bis[2-(dimethylamino)ethyl] ester |
| Adipinsaeure-bis-(2-dimethylamino-aethylester) |
| Adipinsaeure-bis-<2-dimethylamino-ethylester> |
| bis(2-dimethylaminoethyl) hexanedioate |