Pyrimido(4,5-e)-1,2,4-triazine-3,6,8(2H,5H,7H)-trione, 5,7-dimethyl-2-(3-methylphenyl)- structure
|
Common Name | Pyrimido(4,5-e)-1,2,4-triazine-3,6,8(2H,5H,7H)-trione, 5,7-dimethyl-2-(3-methylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 65172-74-9 | Molecular Weight | 299.28500 | |
| Density | 1.47g/cm3 | Boiling Point | 421.3ºC at 760 mmHg | |
| Molecular Formula | C14H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | 5,7-dimethyl-2-(3-methylphenyl)pyrimido[4,5-e][1,2,4]triazine-3,6,8-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 421.3ºC at 760 mmHg |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.28500 |
| Flash Point | 208.6ºC |
| Exact Mass | 299.10200 |
| PSA | 91.78000 |
| Index of Refraction | 1.708 |
| InChIKey | COADKVMHGHITFU-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-n2nc3c(=O)n(C)c(=O)n(C)c3nc2=O)c1 |
|
~59%
Pyrimido(4,5-e)... CAS#:65172-74-9 |
| Literature: Yoneda; Higuchi Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 7 p. 1365 - 1368 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 5,7-dimethyl-2-m-tolyl-2H,5H-pyrimido[4,5-e][1,2,4]triazine-3,6,8-trione |
| Pyrimido[4,5-e]-1,2,4-triazine-3,6,8(2H,5H,7H)-trione,5,7-dimethyl-2-(3-methylphenyl) |
| 6-m-Tolyl-1,3-dimethyl-6,7-dihydro-6-aza-lumazin-7-one |