acetic acid,3-(4-methoxyphenyl)sulfanylbuta-1,3-dien-2-ol structure
|
Common Name | acetic acid,3-(4-methoxyphenyl)sulfanylbuta-1,3-dien-2-ol | ||
|---|---|---|---|---|
| CAS Number | 65174-13-2 | Molecular Weight | 268.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,3-(4-methoxyphenyl)sulfanylbuta-1,3-dien-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O4S |
|---|---|
| Molecular Weight | 268.32900 |
| Exact Mass | 268.07700 |
| PSA | 92.06000 |
| LogP | 3.46360 |
| InChIKey | QBYZHOXTACYDHZ-UHFFFAOYSA-N |
| SMILES | C=C(O)C(=C)Sc1ccc(OC)cc1.CC(=O)O |
|
~91%
acetic acid,3-(... CAS#:65174-13-2 |
| Literature: Trost,B.M.; Vladuchick,W.C.; Bridges,A.J. Journal of the American Chemical Society, 1980 , vol. 102, p. 3548 |
|
~%
acetic acid,3-(... CAS#:65174-13-2 |
| Literature: Trost,B.M.; Vladuchick,W.C.; Bridges,A.J. Journal of the American Chemical Society, 1980 , vol. 102, p. 3548 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Butadien-2-ol,3-[(4-methoxyphenyl)thio]-,acetate |
| 2-acetoxy-3-(4'-methoxyphenylthio)buta-1,3-diene |
| 2-acetoxy-3-(4'-methoxyphenylthio)-1,3-butadiene |