ethyl 2-(8-methyl-8-azabicyclo[3.2.1]oct-3-en-3-yl)acetate structure
|
Common Name | ethyl 2-(8-methyl-8-azabicyclo[3.2.1]oct-3-en-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 65180-06-5 | Molecular Weight | 209.28500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(8-methyl-8-azabicyclo[3.2.1]oct-3-en-3-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19NO2 |
|---|---|
| Molecular Weight | 209.28500 |
| Exact Mass | 209.14200 |
| PSA | 29.54000 |
| LogP | 1.67040 |
| InChIKey | CFWBHCRVZHXSQL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=CC2CCC(C1)N2C |
|
~%
ethyl 2-(8-meth... CAS#:65180-06-5 |
| Literature: Tavasli, Mustafa; O'Hagan, David; Batsanov, Andrei S.; Foxon, Graham R.; Halliwell, Robert F.; Howard, Judith A. K. Journal of the Chemical Society - Perkin Transactions 1, 1999 , # 23 p. 3455 - 3461 |
|
~%
ethyl 2-(8-meth... CAS#:65180-06-5 |
| Literature: Kato; Ito; Nishino; Yamakuni; Takasugi Chemical and pharmaceutical bulletin, 1995 , vol. 43, # 8 p. 1351 - 1357 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| trop-2-en-3-yl-acetic acid ethyl ester |
| 8-Azabicyclo[3.2.1]oct-2-ene-3-acetic acid,8-methyl-,ethyl ester |
| ethyl 8-methyl-8-azabicyclo<3.2.1>oct-2-en-3-ylacetate |