1,3-dioxo-2-benzofuran-5-carboxylic acid,prop-2-en-1-ol,styrene
Modify Date: 2025-09-07 19:19:41
1,3-dioxo-2-benzofuran-5-carboxylic acid,prop-2-en-1-ol,styrene structure
|
Common Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid,prop-2-en-1-ol,styrene | ||
|---|---|---|---|---|
| CAS Number | 65186-04-1 | Molecular Weight | 354.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid,prop-2-en-1-ol,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H18O6 |
|---|---|
| Molecular Weight | 354.35300 |
| Exact Mass | 354.11000 |
| PSA | 100.90000 |
| LogP | 3.18970 |
| InChIKey | OFJKGNMLONVPGE-UHFFFAOYSA-N |
| SMILES | C=CCO.C=Cc1ccccc1.O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| 5-Isobenzofurancarboxylic acid,1,3-dihydro-1,3-dioxo-,polymer with ethenylbenzene and 2-propen-1-ol |
| Trimellitic anhydride,styrene,allyl alcohol polymer |