5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine
Modify Date: 2026-08-02 19:25:44
5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine structure
|
Common Name | 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine | ||
|---|---|---|---|---|
| CAS Number | 652-41-5 | Molecular Weight | 287.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClF3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H9ClF3N3 |
|---|---|
| Molecular Weight | 287.67 |
| InChIKey | QAQGJWNEVGLOSZ-UHFFFAOYSA-N |
| SMILES | Nc1cc(N)c(-c2ccc(Cl)cc2)c(C(F)(F)F)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine? |
| A: The English name of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine is 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine. |
| Q: What is the molecular weight of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine? |
| A: Molecular weight of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine is 287.67. |
| Q: What is the InChIKey of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine? |
| A: InChIKey of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine is QAQGJWNEVGLOSZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 652-41-5? |
| A: Chinese name of 652-41-5 is 652-41-5. |
| Q: What is the CAS number of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine? |
| A: CAS number of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine is 652-41-5. |
| Q: What is the SMILES notation of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine? |
| A: SMILES notation of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine is Nc1cc(N)c(-c2ccc(Cl)cc2)c(C(F)(F)F)n1. |
| Q: What is the molecular formula of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine? |
| A: Molecular formula of 5-(4-Chlorophenyl)-6-(trifluoromethyl)-2,4-pyridinediamine is C12H9ClF3N3. |