2-Acetyl-3,5-dihydroxy-4-methoxybenzeneacetic acid
Modify Date: 2025-09-24 16:28:37
2-Acetyl-3,5-dihydroxy-4-methoxybenzeneacetic acid structure
|
Common Name | 2-Acetyl-3,5-dihydroxy-4-methoxybenzeneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 652-55-1 | Molecular Weight | 240.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Curvulic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12O6 |
|---|---|
| Molecular Weight | 240.20900 |
| Exact Mass | 240.06300 |
| PSA | 104.06000 |
| LogP | 0.93610 |
| InChIKey | QSWOSJNPHIHNIR-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc(CC(=O)O)c(C(C)=O)c1O |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:29511-09-9| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: USP8 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 8
External Id: USP8 FAST DUB HTS Primary
|
|
Name: USP17 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Primary
|
|
Name: USP7 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 7
External Id: USP7 FAST DUB HTS Primary
|
|
Name: USP30 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: ubiquitin specific peptidase 30
External Id: USP30 FAST DUB HTS Confirmation
|
|
Name: USP17 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: ubiquitin specific peptidase 17 like family member 5
External Id: USP17 FAST DUB HTS Confirmation
|
|
Name: UCHL1 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: ubiquitin C-terminal hydrolase L1
External Id: UCHL1 FAST DUB HTS Confirmation
|
|
Name: USP28 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Confirmation
|
|
Name: OTUD3 deubiquitinase inhibition: Dose-response Confirmation
Source: 24642
Target: OTU deubiquitinase 3
External Id: OTUD3 FAST DUB HTS Confirmation
|
|
Name: USP28 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 28
External Id: USP28 FAST DUB HTS Primary
|
|
Name: USP10 deubiquitinase inhibition: Primary qHTS
Source: 24642
Target: ubiquitin specific peptidase 10
External Id: USP10 FAST DUB HTS Primary
|
Total 16, Current Page 1 of 2
1
2
| 2-Acetyl-3,5-dihydroxy-4-methoxy-phenylessigsaeure |
| Curvulinsaeure = 2-Acetyl-3,5-dihydroxy-4-methoxy-phenylessigsaeure |
| Curvulsaeure |