TERT-BUTYL (6-CHLOROPYRAZIN-2-YL)CARBAMATE
TERT-BUTYL (6-CHLOROPYRAZIN-2-YL)CARBAMATE structure
|
Common Name | TERT-BUTYL (6-CHLOROPYRAZIN-2-YL)CARBAMATE | ||
|---|---|---|---|---|
| CAS Number | 652153-48-5 | Molecular Weight | 229.66300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H12ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(6-chloropyrazin-2-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H12ClN3O2 |
|---|---|
| Molecular Weight | 229.66300 |
| Exact Mass | 229.06200 |
| PSA | 64.11000 |
| LogP | 2.55000 |
| InChIKey | CFNQQJOHQAKFCF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cncc(Cl)n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~58%
TERT-BUTYL (6-C... CAS#:652153-48-5 |
| Literature: JANSSEN PHARMACEUTICA, NV; KUO, Gee-Hong; DEANGELIS, Alan; WANG, Aihua; ZHANG, Yan; EMANUEL, Stuart, L.; MIDDLETON, Steve, A. Patent: WO2004/9562 A1, 2004 ; Location in patent: Page 38; 39 ; WO 2004/009562 A1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: Molecular weight of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is 229.66300. |
| Q: What is the InChIKey of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: InChIKey of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is CFNQQJOHQAKFCF-UHFFFAOYSA-N. |
| Q: What is the molecular formula of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: Molecular formula of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is C9H12ClN3O2. |
| Q: What is the SMILES notation of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: SMILES notation of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is CC(C)(C)OC(=O)Nc1cncc(Cl)n1. |
| Q: What is the LogP of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: LogP of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is 2.55000. |
| Q: What is the polar surface area (PSA) of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: Polar surface area (PSA) of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is 64.11000. |
| Q: What is the Chinese name of 652153-48-5? |
| A: Chinese name of 652153-48-5 is 652153-48-5. |
| Q: What is the English name of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: The English name of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is tert-butyl N-(6-chloropyrazin-2-yl)carbamate. |
| Q: What is the CAS number of tert-butyl N-(6-chloropyrazin-2-yl)carbamate? |
| A: CAS number of tert-butyl N-(6-chloropyrazin-2-yl)carbamate is 652153-48-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |