2-Methoxybenzoic acid 4-(methoxycarbonyl)phenyl ester
Modify Date: 2025-12-11 17:18:19
2-Methoxybenzoic acid 4-(methoxycarbonyl)phenyl ester structure
|
Common Name | 2-Methoxybenzoic acid 4-(methoxycarbonyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 65220-51-1 | Molecular Weight | 286.27900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxycarbonylphenyl) 2-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O5 |
|---|---|
| Molecular Weight | 286.27900 |
| Exact Mass | 286.08400 |
| PSA | 61.83000 |
| LogP | 2.70100 |
| InChIKey | CTXJMMGFFBIDDG-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OC(=O)c2ccccc2OC)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(methoxycarbonyl)phenyl 2-methoxybenzoate |
| 4-(2-Methoxybenzoyloxy)-benzoesaeure-methylester |