1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone
![1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone Structure](https://image.chemsrc.com/caspic/170/65236-63-7.png)
1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone structure
|
Common Name | 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 65236-63-7 | Molecular Weight | 240.25700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12N2O2 |
|---|---|
| Molecular Weight | 240.25700 |
| Exact Mass | 240.09000 |
| PSA | 54.98000 |
| LogP | 2.92730 |
| InChIKey | XUJDMPJVPVPDFB-UHFFFAOYSA-N |
| SMILES | COc1cnc(C(C)=O)c2[nH]c3ccccc3c12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
CAS#:17017-66-2
CAS#:81787-94-2
CAS#:137937-00-9
CAS#:137937-01-0
CAS#:19005-93-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of PTP1B (unknown origin) assessed as inhibition rate at 100 uM
Source: ChEMBL
Target: Tyrosine-protein phosphatase non-receptor type 1
External Id: CHEMBL3406732
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| InChI=1/C14H12N2O2/c1-8(17)13-14-12(11(18-2)7-15-13)9-5-3-4-6-10(9)16-14/h3-7,16H,1-2H3 |
| Ethanone,1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl) |
| XUJDMPJVPVPDFB-UHFFFAOYSA |
| 1-Acetyl-4-methoxy(9H)pyrido[3,4-b]indole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: Molecular weight of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is 240.25700. |
| Q: What is the LogP of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: LogP of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is 2.92730. |
| Q: What is the molecular formula of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: Molecular formula of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is C14H12N2O2. |
| Q: What is the InChIKey of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: InChIKey of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is XUJDMPJVPVPDFB-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: The English name of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone. |
| Q: What is the CAS number of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: CAS number of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is 65236-63-7. |
| Q: What are the upstream materials of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: Related upstream materials(CAS) of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone: 17017-66-2;81787-94-2;137937-00-9;137937-01-0;19005-93-7. |
| Q: What English synonyms does 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone have? |
| A: English synonyms of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone: InChI=1/C14H12N2O2/c1-8(17)13-14-12(11(18-2)7-15-13)9-5-3-4-6-10(9)16-14/h3-7,16H,1-2H3, Ethanone,1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl), XUJDMPJVPVPDFB-UHFFFAOYSA, 1-Acetyl-4-methoxy(9H)pyrido[3,4-b]indole. |
| Q: What is the SMILES notation of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: SMILES notation of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is COc1cnc(C(C)=O)c2[nH]c3ccccc3c12. |
| Q: What is the polar surface area (PSA) of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone? |
| A: Polar surface area (PSA) of 1-(4-methoxy-9H-pyrido[3,4-b]indol-1-yl)ethanone is 54.98000. |