2,2,5,5-tetrafluorotetrahydrofuran
2,2,5,5-tetrafluorotetrahydrofuran structure
|
Common Name | 2,2,5,5-tetrafluorotetrahydrofuran | ||
|---|---|---|---|---|
| CAS Number | 65237-17-4 | Molecular Weight | 305.91 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H2Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,5,5-tetrafluorotetrahydrofuran |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H2Br2O3 |
|---|---|
| Molecular Weight | 305.91 |
| Exact Mass | 305.83502 |
| PSA | 9.23000 |
| LogP | 1.98240 |
| InChIKey | DVIKZIPMTWLDLT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Br)Br)C(=O)OC2=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:247045-28-9
CAS#:636-28-2
CAS#:62366-73-8This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: Polar surface area (PSA) of 2,2,5,5-tetrafluorotetrahydrofuran is 9.23000. |
| Q: What is the InChIKey of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: InChIKey of 2,2,5,5-tetrafluorotetrahydrofuran is DVIKZIPMTWLDLT-UHFFFAOYSA-N. |
| Q: What is the English name of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: The English name of 2,2,5,5-tetrafluorotetrahydrofuran is 2,2,5,5-tetrafluorotetrahydrofuran. |
| Q: What is the CAS number of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: CAS number of 2,2,5,5-tetrafluorotetrahydrofuran is 65237-17-4. |
| Q: What is the molecular weight of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: Molecular weight of 2,2,5,5-tetrafluorotetrahydrofuran is 305.91. |
| Q: What is the SMILES notation of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: SMILES notation of 2,2,5,5-tetrafluorotetrahydrofuran is C1=C2C(=CC(=C1Br)Br)C(=O)OC2=O. |
| Q: What is the molecular formula of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: Molecular formula of 2,2,5,5-tetrafluorotetrahydrofuran is C8H2Br2O3. |
| Q: What is the LogP of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: LogP of 2,2,5,5-tetrafluorotetrahydrofuran is 1.98240. |
| Q: What is the Chinese name of 65237-17-4? |
| A: Chinese name of 65237-17-4 is 65237-17-4. |
| Q: What are the downstream products of 2,2,5,5-tetrafluorotetrahydrofuran? |
| A: Related downstream products(CAS) of 2,2,5,5-tetrafluorotetrahydrofuran: 247045-28-9;636-28-2;62366-73-8. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |