N,N-Bis(2-(((methylamino)carbonyl)oxy)ethyl)-2-methoxy-10H-phenothiazi ne-10-carboxamide structure
|
Common Name | N,N-Bis(2-(((methylamino)carbonyl)oxy)ethyl)-2-methoxy-10H-phenothiazi ne-10-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 65241-08-9 | Molecular Weight | 474.53000 | |
| Density | 1.32g/cm3 | Boiling Point | 676.8ºC at 760 mmHg | |
| Molecular Formula | C22H26N4O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.1ºC | |
| Name | 2-[(2-methoxyphenothiazine-10-carbonyl)-[2-(methylcarbamoyloxy)ethyl]amino]ethyl N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 676.8ºC at 760 mmHg |
| Molecular Formula | C22H26N4O6S |
| Molecular Weight | 474.53000 |
| Flash Point | 363.1ºC |
| Exact Mass | 474.15700 |
| PSA | 141.72000 |
| LogP | 3.90570 |
| Index of Refraction | 1.604 |
| InChIKey | JQUDQNNLRWHNJH-UHFFFAOYSA-N |
| SMILES | CNC(=O)OCCN(CCOC(=O)NC)C(=O)N1c2ccccc2Sc2ccc(OC)cc21 |
|
~%
N,N-Bis(2-(((me... CAS#:65241-08-9 |
| Literature: Lambrou; Tsatsas; Champagnac; Pommier European Journal of Medicinal Chemistry, 1977 , vol. 12, # 5 p. 488 - 488 |
|
~%
N,N-Bis(2-(((me... CAS#:65241-08-9 |
| Literature: Lambrou; Tsatsas; Champagnac; Pommier European Journal of Medicinal Chemistry, 1977 , vol. 12, # 5 p. 488 - 488 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 10H-Phenothiazine-10-carboxamide,N,N-bis(2-(((methylamino)carbonyl)oxy)ethyl)-2-methoxy |
| N,N-Bis(2-(((methylamino)carbonyl)oxy)ethyl)-2-methoxy-10H-phenothiazine-10-carboxamide |
| 2-methoxy-phenothiazine-10-carboxylic acid bis-(2-methylcarbamoyloxy-ethyl)-amide |