4-[4-(4-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]aniline structure
|
Common Name | 4-[4-(4-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 65247-06-5 | Molecular Weight | 364.29400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12F4N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[4-(4-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H12F4N2O2 |
|---|---|
| Molecular Weight | 364.29400 |
| Exact Mass | 364.08300 |
| PSA | 70.50000 |
| LogP | 6.15440 |
| InChIKey | OLYSJNQUDPLGNG-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2c(F)c(F)c(Oc3ccc(N)cc3)c(F)c2F)cc1 |
|
~10%
4-[4-(4-aminoph... CAS#:65247-06-5 |
| Literature: Gerasimova, T. N.; Kolchina, E. F.; Kargapolova, I. Yu. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1987 , vol. 36, # 12 p. 2611 - 2615 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1987 , # 12 p. 2814 - 2819 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1.4-Bis(p-Aminophenoxy)tetrafluorbenzol |
| 4,4'-[(2,3,5,6-tetrafluoro-1,4-phenylene)-bis-(oxy)]dianiline |
| 1,4-bis(p-aminophenoxy)tetrafluorobenzene |
| 4,4'-[(2,3,5,6-tetrafluorobenzene-1,4-diyl)bis(oxy)]dianiline |
| 4-[4-(4-aminophenoxy)-2,3,5,6-tetrafluorophenoxy]phenylamine |