Acetic acid,2-(2-naphthalenyloxy)-, 2-(diethylamino)ethyl ester, hydrochloride (1:1)
Acetic acid,2-(2-naphthalenyloxy)-, 2-(diethylamino)ethyl ester, hydrochloride (1:1) structure
|
Common Name | Acetic acid,2-(2-naphthalenyloxy)-, 2-(diethylamino)ethyl ester, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 65249-60-7 | Molecular Weight | 337.84100 | |
| Density | 1.1g/cm3 | Boiling Point | 433.8ºC at 760mmHg | |
| Molecular Formula | C18H24ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760mmHg |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.84100 |
| Flash Point | 216.2ºC |
| Exact Mass | 337.14400 |
| PSA | 38.77000 |
| LogP | 3.90560 |
| Index of Refraction | 1.561 |
| InChIKey | PJHYFDUKYBGUGY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)COc1ccc2ccccc2c1.Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Acetic acid,2-(... CAS#:65249-60-7 |
| Literature: Hoskin Journal of the American Chemical Society, 1956 , vol. 78, p. 3121 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [2]Naphthyloxy-essigsaeure-(2-diaethylamino-aethylester),Hydrochlorid |
| [2]naphthyloxy-acetic acid-(2-diethylamino-ethyl ester),hydrochloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: InChIKey of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride is PJHYFDUKYBGUGY-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: LogP of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride is 3.90560. |
| Q: What is the molecular weight of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: Molecular weight of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride is 337.84100. |
| Q: What is the SMILES notation of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: SMILES notation of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride is CCN(CC)CCOC(=O)COc1ccc2ccccc2c1.Cl. |
| Q: What is the Chinese name of 65249-60-7? |
| A: Chinese name of 65249-60-7 is 65249-60-7. |
| Q: What is the boiling point of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: Boiling point of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride is 433.8ºC at 760mmHg. |
| Q: What are the upstream materials of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: Related upstream materials(CAS) of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride: 120-23-0;100-35-6. |
| Q: What is the CAS number of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: CAS number of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride is 65249-60-7. |
| Q: What is the molecular formula of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride? |
| A: Molecular formula of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride is C18H24ClNO3. |
| Q: What English synonyms does 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride have? |
| A: English synonyms of 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride: [2]Naphthyloxy-essigsaeure-(2-diaethylamino-aethylester),Hydrochlorid, [2]naphthyloxy-acetic acid-(2-diethylamino-ethyl ester),hydrochloride. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |