Acetic acid,2-(2-naphthalenyloxy)-, 2-(diethylamino)ethyl ester, hydrochloride (1:1) structure
|
Common Name | Acetic acid,2-(2-naphthalenyloxy)-, 2-(diethylamino)ethyl ester, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 65249-60-7 | Molecular Weight | 337.84100 | |
| Density | 1.1g/cm3 | Boiling Point | 433.8ºC at 760mmHg | |
| Molecular Formula | C18H24ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 2-(diethylamino)ethyl 2-naphthalen-2-yloxyacetate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760mmHg |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.84100 |
| Flash Point | 216.2ºC |
| Exact Mass | 337.14400 |
| PSA | 38.77000 |
| LogP | 3.90560 |
| Index of Refraction | 1.561 |
| InChIKey | PJHYFDUKYBGUGY-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)COc1ccc2ccccc2c1.Cl |
|
~%
Acetic acid,2-(... CAS#:65249-60-7 |
| Literature: Hoskin Journal of the American Chemical Society, 1956 , vol. 78, p. 3121 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| [2]Naphthyloxy-essigsaeure-(2-diaethylamino-aethylester),Hydrochlorid |
| [2]naphthyloxy-acetic acid-(2-diethylamino-ethyl ester),hydrochloride |