tert-butyl N-[(4-chlorophenyl)carbamoylamino]carbamate structure
|
Common Name | tert-butyl N-[(4-chlorophenyl)carbamoylamino]carbamate | ||
|---|---|---|---|---|
| CAS Number | 6526-81-4 | Molecular Weight | 285.72700 | |
| Density | 1.289g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H16ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-[(4-chlorophenyl)carbamoylamino]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Molecular Formula | C12H16ClN3O3 |
| Molecular Weight | 285.72700 |
| Exact Mass | 285.08800 |
| PSA | 86.44000 |
| LogP | 3.38300 |
| Index of Refraction | 1.571 |
| InChIKey | VTQIAXIDINPWQP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNC(=O)Nc1ccc(Cl)cc1 |
|
~%
tert-butyl N-[(... CAS#:6526-81-4 |
| Literature: Niculescu-Duvaz,I. et al. Canadian Journal of Chemistry, 1966 , vol. 44, p. 1102 - 1105 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3-Di<4<N,N-bis(2-chlorethyl)carbamoyloxy>-phenyl>pentan |