1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione
1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione structure
|
Common Name | 1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione | ||
|---|---|---|---|---|
| CAS Number | 65271-75-2 | Molecular Weight | 410.50600 | |
| Density | 1.262g/cm3 | Boiling Point | 677.2ºC at 760 mmHg | |
| Molecular Formula | C24H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 677.2ºC at 760 mmHg |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.50600 |
| Flash Point | 363.4ºC |
| Exact Mass | 410.22100 |
| PSA | 98.66000 |
| LogP | 3.75700 |
| Index of Refraction | 1.646 |
| InChIKey | UKBIMTYONGBOME-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCCCCCO)ccc(NCCCCCO)c21 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,4-Bis((5-hydr... CAS#:65271-75-2 |
| Literature: Gibson; Anderson; Jenkins; Cairns Pharmacy and Pharmacology Communications, 1999 , vol. 5, # 12 p. 669 - 671 |
|
~40%
1,4-Bis((5-hydr... CAS#:65271-75-2 |
| Literature: Gibson; Anderson; Brown; Hartley; Cassidy; Fox; Cairns Pharmaceutical Sciences, 1996 , vol. 2, # 1 p. 49 - 53 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-bis[(5-hydroxypentyl)amino]anthracene-9,10-dione |
| 1,4-bis(5-hydroxypentylamino)anthraquinone |
| 1,4-(dihydroxypentylamino)anthracene-9,10-dione |
| 1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione have? |
| A: English synonyms of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione: 1,4-bis[(5-hydroxypentyl)amino]anthracene-9,10-dione, 1,4-bis(5-hydroxypentylamino)anthraquinone, 1,4-(dihydroxypentylamino)anthracene-9,10-dione, 1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione. |
| Q: What is the InChIKey of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: InChIKey of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione is UKBIMTYONGBOME-UHFFFAOYSA-N. |
| Q: What is the English name of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: The English name of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione is 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione. |
| Q: What is the molecular formula of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: Molecular formula of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione is C24H30N2O4. |
| Q: What are the upstream materials of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: Related upstream materials(CAS) of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione: 81-64-1;476-60-8;2508-29-4. |
| Q: What is the CAS number of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: CAS number of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione is 65271-75-2. |
| Q: What is the LogP of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: LogP of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione is 3.75700. |
| Q: What is the Chinese name of 65271-75-2? |
| A: Chinese name of 65271-75-2 is 65271-75-2. |
| Q: What is the boiling point of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: Boiling point of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione is 677.2ºC at 760 mmHg. |
| Q: What is the SMILES notation of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione? |
| A: SMILES notation of 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione is O=C1c2ccccc2C(=O)c2c(NCCCCCO)ccc(NCCCCCO)c21. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |