1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione structure
|
Common Name | 1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione | ||
|---|---|---|---|---|
| CAS Number | 65271-75-2 | Molecular Weight | 410.50600 | |
| Density | 1.262g/cm3 | Boiling Point | 677.2ºC at 760 mmHg | |
| Molecular Formula | C24H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.4ºC | |
| Name | 1,4-bis(5-hydroxypentylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 677.2ºC at 760 mmHg |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.50600 |
| Flash Point | 363.4ºC |
| Exact Mass | 410.22100 |
| PSA | 98.66000 |
| LogP | 3.75700 |
| Index of Refraction | 1.646 |
| InChIKey | UKBIMTYONGBOME-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCCCCCO)ccc(NCCCCCO)c21 |
|
~%
1,4-Bis((5-hydr... CAS#:65271-75-2 |
| Literature: Gibson; Anderson; Jenkins; Cairns Pharmacy and Pharmacology Communications, 1999 , vol. 5, # 12 p. 669 - 671 |
|
~40%
1,4-Bis((5-hydr... CAS#:65271-75-2 |
| Literature: Gibson; Anderson; Brown; Hartley; Cassidy; Fox; Cairns Pharmaceutical Sciences, 1996 , vol. 2, # 1 p. 49 - 53 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,4-bis[(5-hydroxypentyl)amino]anthracene-9,10-dione |
| 1,4-bis(5-hydroxypentylamino)anthraquinone |
| 1,4-(dihydroxypentylamino)anthracene-9,10-dione |
| 1,4-Bis((5-hydroxypentyl)amino)-9,10-anthracenedione |