4-tert-butyl-2-[2-(5-tert-butyl-2-methoxyphenyl)ethyl]-1-methoxybenzene structure
|
Common Name | 4-tert-butyl-2-[2-(5-tert-butyl-2-methoxyphenyl)ethyl]-1-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 65276-11-1 | Molecular Weight | 354.52600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-2-[2-(5-tert-butyl-2-methoxyphenyl)ethyl]-1-methoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H34O2 |
|---|---|
| Molecular Weight | 354.52600 |
| Exact Mass | 354.25600 |
| PSA | 18.46000 |
| LogP | 6.08400 |
| InChIKey | JZIQQEUMFFEVTG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)(C)C)cc1CCc1cc(C(C)(C)C)ccc1OC |
|
~%
4-tert-butyl-2-... CAS#:65276-11-1 |
| Literature: Tashiro,M. et al. Journal of Organic Chemistry, 1978 , vol. 43, p. 1413 - 1419 |
|
~%
4-tert-butyl-2-... CAS#:65276-11-1 |
| Literature: Tashiro,M. et al. Journal of Organic Chemistry, 1978 , vol. 43, p. 1413 - 1419 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Benzene,1,1'-(1,2-ethanediyl)bis[5-(1,1-dimethylethyl)-2-methoxy |
| 1,2-bis(5-tert-butyl-2-methoxyphenyl)ethane |
| 1,3-Bis(5-tert-butyl-2-methoxyphenyl)ethane |
| 1,2-Bis(2-methoxy-5-tert-butylphenyl)ethane |
| 5,5'-Di-tert.-butyl-2,2'-dimethoxy-diphenylethan |